Difference between revisions of "SJ11470"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] == * common-name: ** n-acetylglutamyl-phosphate * smil...")
(Created page with "Category:gene == Gene SJ16354 == * transcription-direction: ** negative * right-end-position: ** 105735 * left-end-position: ** 92396 * centisome-position: ** 32.433304...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] ==
+
== Gene SJ16354 ==
−
* common-name:
+
* transcription-direction:
−
** n-acetylglutamyl-phosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
+
** 105735
−
* inchi-key:
+
* left-end-position:
−
** fcvihfvsxhopsw-yfkpbyrvsa-k
+
** 92396
−
* molecular-weight:
+
* centisome-position:
−
** 266.124
+
** 32.433304   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[ACETYLGLUTKIN-RXN]]
+
* [[S.japonica_sterols_curated]]
−
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[2.7.12.1-RXN]]
−
* [[ACETYLGLUTKIN-RXN]]
+
** Category: [[annotation]]
−
* [[AGK]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=n-acetylglutamyl-phosphate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=fcvihfvsxhopsw-yfkpbyrvsa-k}}
+
** Category: [[orthology]]
−
{{#set: molecular-weight=266.124}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=105735}}
 +
{{#set: left-end-position=92396}}
 +
{{#set: centisome-position=32.433304    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}

Revision as of 20:19, 18 December 2020

Gene SJ16354

  • transcription-direction:
    • negative
  • right-end-position:
    • 105735
  • left-end-position:
    • 92396
  • centisome-position:
    • 32.433304

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ11470&oldid=40832"