Difference between revisions of "SJ11476"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE] == * common-name...")
(Created page with "Category:gene == Gene SJ08821 == * transcription-direction: ** negative * right-end-position: ** 44285 * left-end-position: ** 18922 * centisome-position: ** 38.93015...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE] ==
+
== Gene SJ08821 ==
* common-name:
+
* transcription-direction:
** 1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine
+
** negative
* smiles:
+
* right-end-position:
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** 44285
* inchi-key:
+
* left-end-position:
** xxkfqtjojzelmd-jicbsjgisa-n
+
** 18922
* molecular-weight:
+
* centisome-position:
** 778.06
+
** 38.93015   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
* [[RXN-8325]]
+
== Reaction(s) associated ==
* [[RXN-8331]]
+
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=xxkfqtjojzelmd-jicbsjgisa-n}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=778.06}}
+
{{#set: right-end-position=44285}}
 +
{{#set: left-end-position=18922}}
 +
{{#set: centisome-position=38.93015    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:22, 18 December 2020

Gene SJ08821

  • transcription-direction:
    • negative
  • right-end-position:
    • 44285
  • left-end-position:
    • 18922
  • centisome-position:
    • 38.93015

Organism(s) associated with this gene

Reaction(s) associated