Difference between revisions of "SJ11538"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14123 CPD-14123] == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] == |
* common-name: | * common-name: | ||
| − | ** | + | ** triiodothyroacetate ester glucuronide |
* smiles: | * smiles: | ||
| − | ** | + | ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fpejnmnxcsitjo-kfyubchvsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 797.054 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10618]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=triiodothyroacetate ester glucuronide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=797.054}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-11412
- common-name:
- triiodothyroacetate ester glucuronide
- smiles:
- c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
- inchi-key:
- fpejnmnxcsitjo-kfyubchvsa-m
- molecular-weight:
- 797.054
