Difference between revisions of "SJ11568"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-SUCCINYLLL-2-6-DIAMINOPIMELATE N-SUCCINYLLL-2-6-DIAMINOPIMELATE] == * common-name: ** n-succi...")
 
(Created page with "Category:gene == Gene SJ11568 == * transcription-direction: ** positive * right-end-position: ** 48807 * left-end-position: ** 25167 * centisome-position: ** 6.7924557...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-SUCCINYLLL-2-6-DIAMINOPIMELATE N-SUCCINYLLL-2-6-DIAMINOPIMELATE] ==
+
== Gene SJ11568 ==
* common-name:
+
* transcription-direction:
** n-succinyl-l,l-2,6-diaminopimelate
+
** positive
* smiles:
+
* right-end-position:
** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
+
** 48807
* inchi-key:
+
* left-end-position:
** glxuwzbupatpbr-bqbzgakwsa-l
+
** 25167
* molecular-weight:
+
* centisome-position:
** 288.257
+
** 6.7924557   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=n-succinyl-l,l-2,6-diaminopimelate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=glxuwzbupatpbr-bqbzgakwsa-l}}
+
** Category: [[orthology]]
{{#set: molecular-weight=288.257}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=48807}}
 +
{{#set: left-end-position=25167}}
 +
{{#set: centisome-position=6.7924557    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ11568

  • transcription-direction:
    • positive
  • right-end-position:
    • 48807
  • left-end-position:
    • 25167
  • centisome-position:
    • 6.7924557

Organism(s) associated with this gene

Reaction(s) associated