Difference between revisions of "SJ11576"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN GLN] == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key:...") |
(Created page with "Category:gene == Gene SJ11576 == * transcription-direction: ** negative * right-end-position: ** 20293 * left-end-position: ** 15391 * centisome-position: ** 75.03047...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:gene]] |
| − | == | + | == Gene SJ11576 == |
| − | * | + | * transcription-direction: |
| − | ** | + | ** negative |
| − | * | + | * right-end-position: |
| − | ** | + | ** 20293 |
| − | * | + | * left-end-position: |
| − | ** | + | ** 15391 |
| − | * | + | * centisome-position: |
| − | ** | + | ** 75.03047 |
| − | == | + | == Organism(s) associated with this gene == |
| − | + | * [[S.japonica_carotenoid_curated]] | |
| − | * [[ | + | == Reaction(s) associated == |
| − | + | * [[MEVALONATE-KINASE-RXN]] | |
| − | * [[ | + | ** Category: [[annotation]] |
| − | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * | + | ** Category: [[orthology]] |
| − | * [[ | + | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a |
| − | * | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
| − | * | + | == Pathway(s) associated == |
| − | * [[ | + | * [[PWY-7391]] |
| − | + | ** '''7''' reactions found over '''8''' reactions in the full pathway | |
| − | * | + | * [[PWY-922]] |
| − | * [[ | + | ** '''7''' reactions found over '''7''' reactions in the full pathway |
| − | * | + | * [[PWY-6174]] |
| − | * | + | ** '''6''' reactions found over '''7''' reactions in the full pathway |
| − | * [[ | + | {{#set: transcription-direction=negative}} |
| − | + | {{#set: right-end-position=20293}} | |
| − | * | + | {{#set: left-end-position=15391}} |
| − | * | + | {{#set: centisome-position=75.03047 }} |
| − | * [[ | + | {{#set: organism associated=S.japonica_carotenoid_curated}} |
| − | + | {{#set: nb reaction associated=1}} | |
| − | + | {{#set: nb pathway associated=3}} | |
| − | |||
| − | == | ||
| − | * [[ | ||
| − | * | ||
| − | * [[ | ||
| − | * | ||
| − | * [[ | ||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:00, 18 March 2021
Contents
Gene SJ11576
- transcription-direction:
- negative
- right-end-position:
- 20293
- left-end-position:
- 15391
- centisome-position:
- 75.03047
Organism(s) associated with this gene
Reaction(s) associated
- MEVALONATE-KINASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_arabidopsis_thaliana; tool: pantograph; comment: n.a
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-7391
- 7 reactions found over 8 reactions in the full pathway
- PWY-922
- 7 reactions found over 7 reactions in the full pathway
- PWY-6174
- 6 reactions found over 7 reactions in the full pathway
