Difference between revisions of "SJ11576"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN GLN] == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key:...") |
(Created page with "Category:gene == Gene SJ14724 == * transcription-direction: ** positive * right-end-position: ** 115938 * left-end-position: ** 115042 * centisome-position: ** 37.050446...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:gene]] |
| − | == | + | == Gene SJ14724 == |
| − | * | + | * transcription-direction: |
| − | ** | + | ** positive |
| − | * | + | * right-end-position: |
| − | ** | + | ** 115938 |
| − | * | + | * left-end-position: |
| − | ** | + | ** 115042 |
| − | * | + | * centisome-position: |
| − | ** | + | ** 37.050446 |
| − | == | + | == Organism(s) associated with this gene == |
| − | + | * [[S.japonica_sterols_curated]] | |
| − | * [[ | + | == Reaction(s) associated == |
| − | * [[ | + | * [[1.1.1.197-RXN]] |
| − | * | + | ** Category: [[annotation]] |
| − | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | * | + | * [[CARBONYL-REDUCTASE-NADPH-RXN]] |
| − | * | + | ** Category: [[annotation]] |
| − | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | + | * [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]] | |
| − | * [[ | + | ** Category: [[annotation]] |
| − | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | * | + | * [[RIBITOL-2-DEHYDROGENASE-RXN]] |
| − | * [[ | + | ** Category: [[orthology]] |
| − | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[ | + | == Pathway(s) associated == |
| − | * [[ | + | * [[RIBITOLUTIL-PWY]] |
| − | * [[ | + | ** '''1''' reactions found over '''2''' reactions in the full pathway |
| − | + | {{#set: transcription-direction=positive}} | |
| − | * [[ | + | {{#set: right-end-position=115938}} |
| − | * [[ | + | {{#set: left-end-position=115042}} |
| − | * [[ | + | {{#set: centisome-position=37.050446 }} |
| − | + | {{#set: organism associated=S.japonica_sterols_curated}} | |
| − | + | {{#set: nb reaction associated=4}} | |
| − | == | + | {{#set: nb pathway associated=1}} |
| − | * [[ | ||
| − | * | ||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Revision as of 20:19, 18 December 2020
Contents
Gene SJ14724
- transcription-direction:
- positive
- right-end-position:
- 115938
- left-end-position:
- 115042
- centisome-position:
- 37.050446
Organism(s) associated with this gene
Reaction(s) associated
- 1.1.1.197-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- CARBONYL-REDUCTASE-NADPH-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- PROSTAGLANDIN-E2-9-REDUCTASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RIBITOL-2-DEHYDROGENASE-RXN
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology
Pathway(s) associated
- RIBITOLUTIL-PWY
- 1 reactions found over 2 reactions in the full pathway
