Difference between revisions of "SJ11595"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-THF 10-FORMYL-THF] == * common-name: ** 10-formyl-tetrahydrofolate mono-l-glutamate *...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-170 CPD-170] == * common-name: ** stachyose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-THF 10-FORMYL-THF] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-170 CPD-170] ==
 
* common-name:
 
* common-name:
** 10-formyl-tetrahydrofolate mono-l-glutamate
+
** stachyose
 
* smiles:
 
* smiles:
** c2([ch](cn(c=o)c1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))nc3(c(=o)nc(n)=nc(n2)=3))
+
** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
 
* inchi-key:
 
* inchi-key:
** aufgtpparqzwdo-ypmhnxcesa-l
+
** uqziybxshagnoe-xnsrjbnmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 471.429
+
** 666.583
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FPAIF]]
+
* [[2.4.1.67-RXN]]
* [[FPGFTh]]
+
* [[RXN-11501]]
* [[FTHDF]]
 
* [[MTHFCx]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FPAIF]]
+
* [[2.4.1.67-RXN]]
* [[FPGFTh]]
 
* [[FTHFL]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=10-formyl-tetrahydrofolate mono-l-glutamate}}
+
{{#set: common-name=stachyose}}
{{#set: inchi-key=inchikey=aufgtpparqzwdo-ypmhnxcesa-l}}
+
{{#set: inchi-key=inchikey=uqziybxshagnoe-xnsrjbnmsa-n}}
{{#set: molecular-weight=471.429}}
+
{{#set: molecular-weight=666.583}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-170

  • common-name:
    • stachyose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
  • inchi-key:
    • uqziybxshagnoe-xnsrjbnmsa-n
  • molecular-weight:
    • 666.583

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality