Difference between revisions of "SJ11643"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12127 CPD-12127] == * common-name: ** menaquinol-10 * smiles: ** cc(=cccc(=cccc(c)=cccc(c)=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Triacylglycerols Triacylglycerols] == * common-name: ** a triacyl-sn-glycerol == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12127 CPD-12127] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Triacylglycerols Triacylglycerols] ==
 
* common-name:
 
* common-name:
** menaquinol-10
+
** a triacyl-sn-glycerol
* smiles:
 
** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
 
* inchi-key:
 
** wlkiromwgyxjma-uqunhumxsa-n
 
* molecular-weight:
 
** 855.381
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9361]]
+
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-10}}
+
{{#set: common-name=a triacyl-sn-glycerol}}
{{#set: inchi-key=inchikey=wlkiromwgyxjma-uqunhumxsa-n}}
 
{{#set: molecular-weight=855.381}}
 

Revision as of 09:24, 27 August 2019

Metabolite Triacylglycerols

  • common-name:
    • a triacyl-sn-glycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality