Difference between revisions of "SJ11651"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ox-NADPH-Hemoprotein-Reductases Ox-NADPH-Hemoprotein-Reductases] == * common-name: ** an oxidiz...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ox-NADPH-Hemoprotein-Reductases Ox-NADPH-Hemoprotein-Reductases] == |
* common-name: | * common-name: | ||
| − | ** | + | ** an oxidized [nadph-hemoprotein reductase] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17627]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] |
| − | * [[RXN- | + | * [[RXN-11056]] |
| − | * [[ | + | * [[RXN-11057]] |
| − | * [[ | + | * [[RXN-13064]] |
| − | * [[ | + | * [[RXN-17625]] |
| − | * [[ | + | * [[RXN-17627]] |
| − | * [[ | + | * [[RXN-8630]] |
| + | * [[RXN-8872]] | ||
| + | * [[RXN66-146]] | ||
| + | * [[RXN66-161]] | ||
| + | * [[RXN66-163]] | ||
| + | * [[RXN66-169]] | ||
| + | * [[RXN66-181]] | ||
| + | * [[SQUALENE-MONOOXYGENASE-RXN]] | ||
| + | * [[UNSPECIFIC-MONOOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an oxidized [nadph-hemoprotein reductase]}} |
| − | |||
| − | |||
Revision as of 09:24, 27 August 2019
Contents
Metabolite Ox-NADPH-Hemoprotein-Reductases
- common-name:
- an oxidized [nadph-hemoprotein reductase]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- HEME-OXYGENASE-DECYCLIZING-RXN
- RXN-11056
- RXN-11057
- RXN-13064
- RXN-17625
- RXN-17627
- RXN-8630
- RXN-8872
- RXN66-146
- RXN66-161
- RXN66-163
- RXN66-169
- RXN66-181
- SQUALENE-MONOOXYGENASE-RXN
- UNSPECIFIC-MONOOXYGENASE-RXN
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an oxidized [nadph-hemoprotein reductase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
