Difference between revisions of "SJ11668"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17351 CPD-17351] == * smiles: ** cccccc=ccc=ccccccccccc(=o)[a glycerolipid] * common-name:...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * common-name: ** 8-oxo-dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17351 CPD-17351] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] ==
 +
* common-name:
 +
** 8-oxo-dgmp
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccccc(=o)[a glycerolipid]
+
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
* common-name:
+
* inchi-key:
** a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate
+
** aqivlflyhyfrku-vpeninkcsa-l
 +
* molecular-weight:
 +
** 361.207
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16099]]
+
* [[RXN-14205]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11396]]
 +
* [[RXN-12816]]
 +
* [[RXN-14205]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate}}
+
{{#set: common-name=8-oxo-dgmp}}
 +
{{#set: inchi-key=inchikey=aqivlflyhyfrku-vpeninkcsa-l}}
 +
{{#set: molecular-weight=361.207}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-12365

  • common-name:
    • 8-oxo-dgmp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • aqivlflyhyfrku-vpeninkcsa-l
  • molecular-weight:
    • 361.207

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality