Difference between revisions of "SJ11668"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * common-name: ** 8-oxo-dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Adenine-34-in-tRNAs Adenine-34-in-tRNAs] == * common-name: ** an adenine34 in trna == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Adenine-34-in-tRNAs Adenine-34-in-tRNAs] ==
 
* common-name:
 
* common-name:
** 8-oxo-dgmp
+
** an adenine34 in trna
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
** aqivlflyhyfrku-vpeninkcsa-l
 
* molecular-weight:
 
** 361.207
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14205]]
+
* [[RXN-13997]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11396]]
+
* [[RXN-13997]]
* [[RXN-12816]]
 
* [[RXN-14205]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-oxo-dgmp}}
+
{{#set: common-name=an adenine34 in trna}}
{{#set: inchi-key=inchikey=aqivlflyhyfrku-vpeninkcsa-l}}
 
{{#set: molecular-weight=361.207}}
 

Revision as of 09:24, 27 August 2019

Metabolite Adenine-34-in-tRNAs

  • common-name:
    • an adenine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality