Difference between revisions of "SJ11677"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-4-AMINO-4-DEOXY-L-ARABINOSE UDP-4-AMINO-4-DEOXY-L-ARABINOSE] == * common-name: ** udp-4-ami...")
(Created page with "Category:gene == Gene SJ11677 == * transcription-direction: ** positive * right-end-position: ** 209773 * left-end-position: ** 201052 * centisome-position: ** 54.351746...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-4-AMINO-4-DEOXY-L-ARABINOSE UDP-4-AMINO-4-DEOXY-L-ARABINOSE] ==
+
== Gene SJ11677 ==
−
* common-name:
+
* transcription-direction:
−
** udp-4-amino-4-deoxy-β-l-arabinopyranose
+
** positive
−
* smiles:
+
* right-end-position:
−
** c(op(=o)([o-])op(=o)([o-])oc1(occ([n+])c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
+
** 209773
−
* inchi-key:
+
* left-end-position:
−
** gwbakybswhqnmq-iazovdbxsa-m
+
** 201052
−
* molecular-weight:
+
* centisome-position:
−
** 534.286
+
** 54.351746   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN0-1863]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN0-1863]]
+
* [[RXN-11836]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=udp-4-amino-4-deoxy-β-l-arabinopyranose}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=gwbakybswhqnmq-iazovdbxsa-m}}
+
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
−
{{#set: molecular-weight=534.286}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=209773}}
 +
{{#set: left-end-position=201052}}
 +
{{#set: centisome-position=54.351746    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}

Revision as of 20:20, 18 December 2020

Gene SJ11677

  • transcription-direction:
    • positive
  • right-end-position:
    • 209773
  • left-end-position:
    • 201052
  • centisome-position:
    • 54.351746

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ11677&oldid=40856"