Difference between revisions of "SJ11687"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == * common-name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * common-name: ** (2r,3s)-3-methylmalate * smiles: ** cc(c(=o)[o-])c(o)c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2r,3s)-3-methylmalate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c(=o)[o-])c(o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** npyqjihhtgfbln-sthayslisa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 146.099 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7745]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2r,3s)-3-methylmalate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=npyqjihhtgfbln-sthayslisa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=146.099}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-7066
- common-name:
- (2r,3s)-3-methylmalate
- smiles:
- cc(c(=o)[o-])c(o)c([o-])=o
- inchi-key:
- npyqjihhtgfbln-sthayslisa-l
- molecular-weight:
- 146.099
