Difference between revisions of "SJ11692"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-HEXANOYL-COA OH-HEXANOYL-COA] == * common-name: ** (s)-3-hydroxyhexanoyl-coa * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE] == * common-na...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-HEXANOYL-COA OH-HEXANOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE] ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxyhexanoyl-coa
+
** 6-(hydroxymethyl)-7,8-dihydropterin
 
* smiles:
 
* smiles:
** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
+
** c(o)c2(=nc1(c(=o)nc(n)=nc=1nc2))
 
* inchi-key:
 
* inchi-key:
** vaahkrmgofiorx-dwufxmdisa-j
+
** cqqnnqtxugluev-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 877.646
+
** 195.18
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH2h]]
+
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
* [[HACD2h]]
 
* [[RXN-12567]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECOAH2h]]
+
* [[H2NEOPTERINALDOL-RXN]]
* [[HACD2h]]
+
* [[RXN-10857]]
* [[RXN-12570]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxyhexanoyl-coa}}
+
{{#set: common-name=6-(hydroxymethyl)-7,8-dihydropterin}}
{{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}}
+
{{#set: inchi-key=inchikey=cqqnnqtxugluev-uhfffaoysa-n}}
{{#set: molecular-weight=877.646}}
+
{{#set: molecular-weight=195.18}}

Revision as of 09:24, 27 August 2019

Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE

  • common-name:
    • 6-(hydroxymethyl)-7,8-dihydropterin
  • smiles:
    • c(o)c2(=nc1(c(=o)nc(n)=nc=1nc2))
  • inchi-key:
    • cqqnnqtxugluev-uhfffaoysa-n
  • molecular-weight:
    • 195.18

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality