Difference between revisions of "SJ11730"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o...")
(Created page with "Category:gene == Gene SJ06042 == * transcription-direction: ** negative * right-end-position: ** 224267 * left-end-position: ** 206792 * centisome-position: ** 42.841045...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] ==
+
== Gene SJ06042 ==
−
* common-name:
+
* transcription-direction:
−
** sirohydrochlorin
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
+
** 224267
−
* inchi-key:
+
* left-end-position:
−
** kwizrxmmfrbuml-ahgfgahvsa-f
+
** 206792
−
* molecular-weight:
+
* centisome-position:
−
** 854.779
+
** 42.841045   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[4.99.1.3-RXN]]
+
* [[S.japonica_sterols_curated]]
−
* [[SIROHEME-FERROCHELAT-RXN]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[2.7.13.3-RXN]]
−
* [[DIMETHUROPORDEHYDROG-RXN]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=sirohydrochlorin}}
+
* [[PROTEIN-KINASE-RXN]]
−
{{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}}
+
** Category: [[annotation]]
−
{{#set: molecular-weight=854.779}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=224267}}
 +
{{#set: left-end-position=206792}}
 +
{{#set: centisome-position=42.841045    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}

Revision as of 20:21, 18 December 2020

Gene SJ06042

  • transcription-direction:
    • negative
  • right-end-position:
    • 224267
  • left-end-position:
    • 206792
  • centisome-position:
    • 42.841045

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ11730&oldid=41614"