Difference between revisions of "SJ11781"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-SUCCINYL-2-AMINO-6-KETOPIMELATE N-SUCCINYL-2-AMINO-6-KETOPIMELATE] == * common-name: ** n-suc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * common-name: ** (4s)-4-hydroxy-2-oxoglutarate * smiles: ** c(c(=o)c([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-SUCCINYL-2-AMINO-6-KETOPIMELATE N-SUCCINYL-2-AMINO-6-KETOPIMELATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] ==
 
* common-name:
 
* common-name:
** n-succinyl-2-amino-6-ketopimelate
+
** (4s)-4-hydroxy-2-oxoglutarate
 
* smiles:
 
* smiles:
** c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
+
** c(c(=o)c([o-])=o)c(c([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** sdvxscsnvvzwdd-lurjtmiesa-k
+
** wxskvkpsmahcsg-reohclbhsa-l
 
* molecular-weight:
 
* molecular-weight:
** 286.218
+
** 160.083
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+
* [[RXN-13990]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+
* [[RXN-13990]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-succinyl-2-amino-6-ketopimelate}}
+
{{#set: common-name=(4s)-4-hydroxy-2-oxoglutarate}}
{{#set: inchi-key=inchikey=sdvxscsnvvzwdd-lurjtmiesa-k}}
+
{{#set: inchi-key=inchikey=wxskvkpsmahcsg-reohclbhsa-l}}
{{#set: molecular-weight=286.218}}
+
{{#set: molecular-weight=160.083}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-15016

  • common-name:
    • (4s)-4-hydroxy-2-oxoglutarate
  • smiles:
    • c(c(=o)c([o-])=o)c(c([o-])=o)o
  • inchi-key:
    • wxskvkpsmahcsg-reohclbhsa-l
  • molecular-weight:
    • 160.083

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality