Difference between revisions of "SJ11781"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * common-name: ** (4s)-4-hydroxy-2-oxoglutarate * smiles: ** c(c(=o)c([...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Ligase-L-lysine-guanylate DNA-Ligase-L-lysine-guanylate] == * common-name: ** a [dna ligase...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Ligase-L-lysine-guanylate DNA-Ligase-L-lysine-guanylate] ==
 
* common-name:
 
* common-name:
** (4s)-4-hydroxy-2-oxoglutarate
+
** a [dna ligase]-l-lysine-guanylate
* smiles:
 
** c(c(=o)c([o-])=o)c(c([o-])=o)o
 
* inchi-key:
 
** wxskvkpsmahcsg-reohclbhsa-l
 
* molecular-weight:
 
** 160.083
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13990]]
+
* [[RXN-17922]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13990]]
+
* [[RXN-17921]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4s)-4-hydroxy-2-oxoglutarate}}
+
{{#set: common-name=a [dna ligase]-l-lysine-guanylate}}
{{#set: inchi-key=inchikey=wxskvkpsmahcsg-reohclbhsa-l}}
 
{{#set: molecular-weight=160.083}}
 

Revision as of 09:23, 27 August 2019

Metabolite DNA-Ligase-L-lysine-guanylate

  • common-name:
    • a [dna ligase]-l-lysine-guanylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [dna ligase]-l-lysine-guanylate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.