Difference between revisions of "SJ11801"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkyl-glycerol-3-phosphate 1-Alkyl-glycerol-3-phosphate] == * common-name: ** a 1-alkyl-sn-gl...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == * common-name: ** pseudouridine 5'-phosphate * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == |
* common-name: | * common-name: | ||
| − | ** | + | ** pseudouridine 5'-phosphate |
| + | * smiles: | ||
| + | ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) | ||
| + | * inchi-key: | ||
| + | ** mobmojgxnhllir-gbndhiklsa-l | ||
| + | * molecular-weight: | ||
| + | ** 322.168 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15703]] |
| + | * [[RXN0-5398]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[PSEUDOURIDINE-KINASE-RXN]] |
| + | * [[RXN-15703]] | ||
| + | * [[RXN0-5398]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pseudouridine 5'-phosphate}} |
| + | {{#set: inchi-key=inchikey=mobmojgxnhllir-gbndhiklsa-l}} | ||
| + | {{#set: molecular-weight=322.168}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite PSEUDOURIDINE-5-P
- common-name:
- pseudouridine 5'-phosphate
- smiles:
- c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))
- inchi-key:
- mobmojgxnhllir-gbndhiklsa-l
- molecular-weight:
- 322.168
