Difference between revisions of "SJ11813"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=56-Dihydrouracil16-in-tRNAs 56-Dihydrouracil16-in-tRNAs] == * common-name: ** a 5,6-dihydrourac...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] == * common-name: ** (2e,5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=56-Dihydrouracil16-in-tRNAs 56-Dihydrouracil16-in-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] ==
 
* common-name:
 
* common-name:
** a 5,6-dihydrouracil16 in trna
+
** (2e,5z)-tetradecenoyl-coa
 +
* smiles:
 +
** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** jvefyxpcqbmmaa-zmlwrgbosa-j
 +
* molecular-weight:
 +
** 969.83
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5393]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12454]]
+
* [[RXN-14576]]
 +
* [[RXN-17783]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5,6-dihydrouracil16 in trna}}
+
{{#set: common-name=(2e,5z)-tetradecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}}
 +
{{#set: molecular-weight=969.83}}

Revision as of 14:19, 26 August 2019

Metabolite CPD0-1162

  • common-name:
    • (2e,5z)-tetradecenoyl-coa
  • smiles:
    • ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • jvefyxpcqbmmaa-zmlwrgbosa-j
  • molecular-weight:
    • 969.83

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality