Difference between revisions of "SJ11977"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * i...") |
(Created page with "Category:gene == Gene SJ11977 == * transcription-direction: ** positive * right-end-position: ** 171566 * left-end-position: ** 154883 * centisome-position: ** 42.712914...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ11977 == |
− | * | + | * transcription-direction: |
− | ** | + | ** positive |
− | * | + | * right-end-position: |
− | ** | + | ** 171566 |
− | * | + | * left-end-position: |
− | ** | + | ** 154883 |
− | * | + | * centisome-position: |
− | ** | + | ** 42.712914 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | == Reaction(s) | + | == Reaction(s) associated == |
− | * [[RXN | + | * [[PROTEIN-KINASE-RXN]] |
− | + | ** Category: [[annotation]] | |
− | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | {{#set: | + | ** Category: [[orthology]] |
− | {{#set: | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
+ | {{#set: transcription-direction=positive}} | ||
+ | {{#set: right-end-position=171566}} | ||
+ | {{#set: left-end-position=154883}} | ||
+ | {{#set: centisome-position=42.712914 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=1}} |
Latest revision as of 11:02, 18 March 2021
Gene SJ11977
- transcription-direction:
- positive
- right-end-position:
- 171566
- left-end-position:
- 154883
- centisome-position:
- 42.712914
Organism(s) associated with this gene
Reaction(s) associated
- PROTEIN-KINASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation