Difference between revisions of "SJ11977"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * i...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfur-Carrier-Proteins-ThiI Sulfur-Carrier-Proteins-ThiI] == * common-name: ** a [thii sulfur-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfur-Carrier-Proteins-ThiI Sulfur-Carrier-Proteins-ThiI] == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [thii sulfur-carrier protein]-l-cysteine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14382]] |
| + | * [[RXN-9787]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9787]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [thii sulfur-carrier protein]-l-cysteine}} |
| − | |||
| − | |||
Revision as of 14:20, 26 August 2019
Contents
Metabolite Sulfur-Carrier-Proteins-ThiI
- common-name:
- a [thii sulfur-carrier protein]-l-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [thii sulfur-carrier protein]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
