Difference between revisions of "SJ12040"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1108 CPD-1108] == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 4-phosphate == Reactio...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1445 CPD0-1445] == * common-name: ** l-alanyl-l-glutamate * smiles: ** cc([n+])c(=o)nc(c([...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1445 CPD0-1445] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-glutamate |
| + | * smiles: | ||
| + | ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** vyzagtdahuirqa-whfbiakzsa-m | ||
| + | * molecular-weight: | ||
| + | ** 217.201 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6981]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-glutamate}} |
| + | {{#set: inchi-key=inchikey=vyzagtdahuirqa-whfbiakzsa-m}} | ||
| + | {{#set: molecular-weight=217.201}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD0-1445
- common-name:
- l-alanyl-l-glutamate
- smiles:
- cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-]
- inchi-key:
- vyzagtdahuirqa-whfbiakzsa-m
- molecular-weight:
- 217.201
