Difference between revisions of "SJ12040"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1445 CPD0-1445] == * common-name: ** l-alanyl-l-glutamate * smiles: ** cc([n+])c(=o)nc(c([...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-LYS-tRNAs Charged-LYS-tRNAs] == * common-name: ** an l-lysyl-[trnalys] == Reaction(s) k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1445 CPD0-1445] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-LYS-tRNAs Charged-LYS-tRNAs] ==
 
* common-name:
 
* common-name:
** l-alanyl-l-glutamate
+
** an l-lysyl-[trnalys]
* smiles:
 
** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-]
 
* inchi-key:
 
** vyzagtdahuirqa-whfbiakzsa-m
 
* molecular-weight:
 
** 217.201
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6981]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[LYSINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-alanyl-l-glutamate}}
+
{{#set: common-name=an l-lysyl-[trnalys]}}
{{#set: inchi-key=inchikey=vyzagtdahuirqa-whfbiakzsa-m}}
 
{{#set: molecular-weight=217.201}}
 

Revision as of 09:24, 27 August 2019

Metabolite Charged-LYS-tRNAs

  • common-name:
    • an l-lysyl-[trnalys]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-lysyl-[trnalys" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.