Difference between revisions of "SJ12047"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * common-name: ** prephytoene diphosphate * smiles: ** cc(=cccc(=cccc(=cccc...")
(Created page with "Category:gene == Gene SJ08230 == * transcription-direction: ** negative * right-end-position: ** 52222 * left-end-position: ** 49666 * centisome-position: ** 88.21356...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] ==
+
== Gene SJ08230 ==
* common-name:
+
* transcription-direction:
** prephytoene diphosphate
+
** negative
* smiles:
+
* right-end-position:
** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c
+
** 52222
* inchi-key:
+
* left-end-position:
** rvcnktpchznaao-imslgmfesa-k
+
** 49666
* molecular-weight:
+
* centisome-position:
** 719.897
+
** 88.21356   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXNARA-8002]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[2.5.1.32-RXN]]
+
* [[3.5.1.26-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=prephytoene diphosphate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=rvcnktpchznaao-imslgmfesa-k}}
+
== Pathway(s) associated ==
{{#set: molecular-weight=719.897}}
+
* [[ASPARAGINE-DEG1-PWY-1]]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=52222}}
 +
{{#set: left-end-position=49666}}
 +
{{#set: centisome-position=88.21356    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:22, 18 December 2020

Gene SJ08230

  • transcription-direction:
    • negative
  • right-end-position:
    • 52222
  • left-end-position:
    • 49666
  • centisome-position:
    • 88.21356

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated