Difference between revisions of "SJ12116"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Semiquinones Semiquinones] == * common-name: ** a semiquinone == Reaction(s) known to consume t...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE] == * common-name: ** u...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Semiquinones Semiquinones] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE] ==
 
* common-name:
 
* common-name:
** a semiquinone
+
** udp-n-acetyl-α-d-glucosamine-enolpyruvate
 +
* smiles:
 +
** c=c(oc3(c(o)c(co)oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(nc(c)=o)3))c(=o)[o-]
 +
* inchi-key:
 +
** begzzypuncjhkp-dbywsuqtsa-k
 +
* molecular-weight:
 +
** 674.382
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[QOR-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a semiquinone}}
+
{{#set: common-name=udp-n-acetyl-α-d-glucosamine-enolpyruvate}}
 +
{{#set: inchi-key=inchikey=begzzypuncjhkp-dbywsuqtsa-k}}
 +
{{#set: molecular-weight=674.382}}

Revision as of 14:19, 26 August 2019

Metabolite UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE

  • common-name:
    • udp-n-acetyl-α-d-glucosamine-enolpyruvate
  • smiles:
    • c=c(oc3(c(o)c(co)oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(nc(c)=o)3))c(=o)[o-]
  • inchi-key:
    • begzzypuncjhkp-dbywsuqtsa-k
  • molecular-weight:
    • 674.382

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality