Difference between revisions of "SJ12148"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08897 == * transcription-direction: ** positive * right-end-position: ** 28477 * left-end-position: ** 26993 * centisome-position: ** 57.449024...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] == * common-name: ** gdp-α-d-glucose * smiles: ** c(o)c1(c(o...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ08897 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] ==
* transcription-direction:
+
* common-name:
** positive
+
** gdp-α-d-glucose
* right-end-position:
+
* smiles:
** 28477
+
** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
* left-end-position:
+
* inchi-key:
** 26993
+
** mvmscbbuihutgj-lrjdveewsa-l
* centisome-position:
+
* molecular-weight:
** 57.449024   
+
** 603.329
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-12486]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[RXN-12486]]
** Category: [[annotation]]
+
* [[RXN4FS-13]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
{{#set: transcription-direction=positive}}
+
{{#set: common-name=gdp-α-d-glucose}}
{{#set: right-end-position=28477}}
+
{{#set: inchi-key=inchikey=mvmscbbuihutgj-lrjdveewsa-l}}
{{#set: left-end-position=26993}}
+
{{#set: molecular-weight=603.329}}
{{#set: centisome-position=57.449024    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 09:25, 27 August 2019

Metabolite GDP-D-GLUCOSE

  • common-name:
    • gdp-α-d-glucose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
  • inchi-key:
    • mvmscbbuihutgj-lrjdveewsa-l
  • molecular-weight:
    • 603.329

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality