Difference between revisions of "SJ12148"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08897 == * transcription-direction: ** positive * right-end-position: ** 28477 * left-end-position: ** 26993 * centisome-position: ** 57.449024...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] == * common-name: ** gdp-α-d-glucose * smiles: ** c(o)c1(c(o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] == |
− | * | + | * common-name: |
− | ** | + | ** gdp-α-d-glucose |
− | * | + | * smiles: |
− | ** | + | ** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34)))) |
− | * | + | * inchi-key: |
− | ** | + | ** mvmscbbuihutgj-lrjdveewsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 603.329 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-12486]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-12486]] |
− | * | + | * [[RXN4FS-13]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=gdp-α-d-glucose}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=mvmscbbuihutgj-lrjdveewsa-l}} |
− | + | {{#set: molecular-weight=603.329}} | |
− | {{#set: | ||
− | |||
− |
Revision as of 09:25, 27 August 2019
Contents
Metabolite GDP-D-GLUCOSE
- common-name:
- gdp-α-d-glucose
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
- inchi-key:
- mvmscbbuihutgj-lrjdveewsa-l
- molecular-weight:
- 603.329