Difference between revisions of "SJ12166"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARALDEHYDE COUMARALDEHYDE] == * common-name: ** 4-coumaraldehyde * smiles: ** c(=o)c=cc1(c=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * common-name: ** 7-methylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7-methylurate |
* smiles: | * smiles: | ||
| − | ** c(=o) | + | ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yhnnpkufpwltop-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 182.138 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11521]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7-methylurate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yhnnpkufpwltop-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=182.138}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-12481
- common-name:
- 7-methylurate
- smiles:
- cn1(c(=o)nc2(=c1c(=o)nc(=o)n2))
- inchi-key:
- yhnnpkufpwltop-uhfffaoysa-n
- molecular-weight:
- 182.138
