Difference between revisions of "SJ12237"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] == * common-name: ** (2e,9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccc...")
 
(Created page with "Category:gene == Gene SJ12237 == * transcription-direction: ** negative * right-end-position: ** 196218 * left-end-position: ** 175413 * centisome-position: ** 48.70608...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] ==
+
== Gene SJ12237 ==
−
* common-name:
+
* transcription-direction:
−
** (2e,9z)-octadecenoyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 196218
−
* inchi-key:
+
* left-end-position:
−
** reoymonhghuley-ppsvnwdxsa-j
+
** 175413
−
* molecular-weight:
+
* centisome-position:
−
** 1025.937
+
** 48.70608   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-17776]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-17775]]
+
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=(2e,9z)-octadecenoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=reoymonhghuley-ppsvnwdxsa-j}}
+
* [[LYSINE--TRNA-LIGASE-RXN]]
−
{{#set: molecular-weight=1025.937}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[TRNA-CHARGING-PWY]]
 +
** '''21''' reactions found over '''21''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=196218}}
 +
{{#set: left-end-position=175413}}
 +
{{#set: centisome-position=48.70608    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:04, 18 March 2021

Gene SJ12237

  • transcription-direction:
    • negative
  • right-end-position:
    • 196218
  • left-end-position:
    • 175413
  • centisome-position:
    • 48.70608

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ12237&oldid=133315"