Difference between revisions of "SJ12237"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] == * common-name: ** (2e,9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * common-name: ** tributyrin * smiles: ** cccc(occ(oc(ccc)=o)coc(ccc)=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] ==
 
* common-name:
 
* common-name:
** (2e,9z)-octadecenoyl-coa
+
** tributyrin
 
* smiles:
 
* smiles:
** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccc(occ(oc(ccc)=o)coc(ccc)=o)=o
 
* inchi-key:
 
* inchi-key:
** reoymonhghuley-ppsvnwdxsa-j
+
** uyxtwwcetriedr-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1025.937
+
** 302.367
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17776]]
+
* [[RXN-12086]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17775]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,9z)-octadecenoyl-coa}}
+
{{#set: common-name=tributyrin}}
{{#set: inchi-key=inchikey=reoymonhghuley-ppsvnwdxsa-j}}
+
{{#set: inchi-key=inchikey=uyxtwwcetriedr-uhfffaoysa-n}}
{{#set: molecular-weight=1025.937}}
+
{{#set: molecular-weight=302.367}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-13014

  • common-name:
    • tributyrin
  • smiles:
    • cccc(occ(oc(ccc)=o)coc(ccc)=o)=o
  • inchi-key:
    • uyxtwwcetriedr-uhfffaoysa-n
  • molecular-weight:
    • 302.367

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality