Difference between revisions of "SJ12257"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-methylcrotonoyl-CoA-carboxylase-lysine 3-methylcrotonoyl-CoA-carboxylase-lysine] == * common-...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12676 CPD-12676] == * common-name: ** 5'-chloro-5'-deoxyadenosine * smiles: ** c(c3(c(c(c(n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12676 CPD-12676] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5'-chloro-5'-deoxyadenosine |
| + | * smiles: | ||
| + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl | ||
| + | * inchi-key: | ||
| + | ** iysnpomtkfzdhz-kqynxxcusa-n | ||
| + | * molecular-weight: | ||
| + | ** 285.689 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11715]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5'-chloro-5'-deoxyadenosine}} |
| + | {{#set: inchi-key=inchikey=iysnpomtkfzdhz-kqynxxcusa-n}} | ||
| + | {{#set: molecular-weight=285.689}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-12676
- common-name:
- 5'-chloro-5'-deoxyadenosine
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl
- inchi-key:
- iysnpomtkfzdhz-kqynxxcusa-n
- molecular-weight:
- 285.689
