Difference between revisions of "SJ12264"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == * common-name: ** (r)-mevalonate 5-phosphate * smiles: ** cc(o)(ccop(=o)([o...")
 
(Created page with "Category:gene == Gene SJ12264 == * transcription-direction: ** positive * right-end-position: ** 190175 * left-end-position: ** 188719 * centisome-position: ** 52.403313...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] ==
+
== Gene SJ12264 ==
* common-name:
+
* transcription-direction:
** (r)-mevalonate 5-phosphate
+
** positive
* smiles:
+
* right-end-position:
** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
+
** 190175
* inchi-key:
+
* left-end-position:
** okzycxhttzzysk-zcfiwibfsa-k
+
** 188719
* molecular-weight:
+
* centisome-position:
** 225.115
+
** 52.403313   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[MEVALONATE-KINASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[2.7.11.24-RXN]]
* [[MEVALONATE-KINASE-RXN]]
+
** Category: [[annotation]]
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
* [[PROTEIN-KINASE-RXN]]
{{#set: common-name=(r)-mevalonate 5-phosphate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=okzycxhttzzysk-zcfiwibfsa-k}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=225.115}}
+
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=190175}}
 +
{{#set: left-end-position=188719}}
 +
{{#set: centisome-position=52.403313    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:01, 18 March 2021

Gene SJ12264

  • transcription-direction:
    • positive
  • right-end-position:
    • 190175
  • left-end-position:
    • 188719
  • centisome-position:
    • 52.403313

Organism(s) associated with this gene

Reaction(s) associated