Difference between revisions of "SJ12264"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == * common-name: ** (r)-mevalonate 5-phosphate * smiles: ** cc(o)(ccop(=o)([o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHIONINE-SYNTHASE-METHYLCOBALAMIN METHIONINE-SYNTHASE-METHYLCOBALAMIN] == * common-name: ** a...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHIONINE-SYNTHASE-METHYLCOBALAMIN METHIONINE-SYNTHASE-METHYLCOBALAMIN] ==
 
* common-name:
 
* common-name:
** (r)-mevalonate 5-phosphate
+
** a [methionine synthase]-methylcob(i)alamin
* smiles:
 
** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
 
* inchi-key:
 
** okzycxhttzzysk-zcfiwibfsa-k
 
* molecular-weight:
 
** 225.115
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MEVALONATE-KINASE-RXN]]
+
* [[2.1.1.135-RXN]]
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MEVALONATE-KINASE-RXN]]
 
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-mevalonate 5-phosphate}}
+
{{#set: common-name=a [methionine synthase]-methylcob(i)alamin}}
{{#set: inchi-key=inchikey=okzycxhttzzysk-zcfiwibfsa-k}}
 
{{#set: molecular-weight=225.115}}
 

Revision as of 14:19, 26 August 2019

Metabolite METHIONINE-SYNTHASE-METHYLCOBALAMIN

  • common-name:
    • a [methionine synthase]-methylcob(i)alamin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [methionine synthase]-methylcob(i)alamin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.