Difference between revisions of "SJ12279"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == * common-name: ** 2-isopropylmaleate * smiles: ** cc(c(c(=o)[o-])=cc(=o)[...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13610 CPD-13610] == * common-name: ** 3-dehydrosphinganine (c20) * smiles: ** ccccccccccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13610 CPD-13610] ==
 
* common-name:
 
* common-name:
** 2-isopropylmaleate
+
** 3-dehydrosphinganine (c20)
 
* smiles:
 
* smiles:
** cc(c(c(=o)[o-])=cc(=o)[o-])c
+
** cccccccccccccccccc(=o)c([n+])co
 
* inchi-key:
 
* inchi-key:
** njmgrjlqrlfqqx-hyxafxhysa-l
+
** fvolnxkbislpqy-ibgzpjmesa-o
 
* molecular-weight:
 
* molecular-weight:
** 156.138
+
** 328.557
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-ISOPROPYLMALISOM-RXN]]
+
* [[RXN-12642]]
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
 
* [[RXN-8991]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3-ISOPROPYLMALISOM-RXN]]
+
* [[RXN-12642]]
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
 
* [[RXN-8991]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-isopropylmaleate}}
+
{{#set: common-name=3-dehydrosphinganine (c20)}}
{{#set: inchi-key=inchikey=njmgrjlqrlfqqx-hyxafxhysa-l}}
+
{{#set: inchi-key=inchikey=fvolnxkbislpqy-ibgzpjmesa-o}}
{{#set: molecular-weight=156.138}}
+
{{#set: molecular-weight=328.557}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-13610

  • common-name:
    • 3-dehydrosphinganine (c20)
  • smiles:
    • cccccccccccccccccc(=o)c([n+])co
  • inchi-key:
    • fvolnxkbislpqy-ibgzpjmesa-o
  • molecular-weight:
    • 328.557

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality