Difference between revisions of "SJ12321"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-RADYL-2-ACETYL-SN-GLYCERO-3-PHOSPHOLIP 1-RADYL-2-ACETYL-SN-GLYCERO-3-PHOSPHOLIP] == * smiles:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] == * common-name: ** dtdp-β-l-rhamnose * smiles: ** cc1(=cn(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] == |
+ | * common-name: | ||
+ | ** dtdp-β-l-rhamnose | ||
* smiles: | * smiles: | ||
− | ** cc(=o) | + | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3)) |
− | * | + | * inchi-key: |
− | ** | + | ** zosqfdvxnqfkby-cgaxjhmrsa-l |
+ | * molecular-weight: | ||
+ | ** 546.317 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[DTDPDEHYRHAMREDUCT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dtdp-β-l-rhamnose}} |
+ | {{#set: inchi-key=inchikey=zosqfdvxnqfkby-cgaxjhmrsa-l}} | ||
+ | {{#set: molecular-weight=546.317}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite DTDP-RHAMNOSE
- common-name:
- dtdp-β-l-rhamnose
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))
- inchi-key:
- zosqfdvxnqfkby-cgaxjhmrsa-l
- molecular-weight:
- 546.317