Difference between revisions of "SJ12321"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] == * common-name: ** dtdp-β-l-rhamnose * smiles: ** cc1(=cn(c...")
(Created page with "Category:gene == Gene SJ17379 == * transcription-direction: ** negative * right-end-position: ** 67555 * left-end-position: ** 35350 * centisome-position: ** 10.349027...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] ==
+
== Gene SJ17379 ==
* common-name:
+
* transcription-direction:
** dtdp-β-l-rhamnose
+
** negative
* smiles:
+
* right-end-position:
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))
+
** 67555
* inchi-key:
+
* left-end-position:
** zosqfdvxnqfkby-cgaxjhmrsa-l
+
** 35350
* molecular-weight:
+
* centisome-position:
** 546.317
+
** 10.349027   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
* [[DTDPDEHYRHAMREDUCT-RXN]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[RXN-15561]]
{{#set: common-name=dtdp-β-l-rhamnose}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=zosqfdvxnqfkby-cgaxjhmrsa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=546.317}}
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=67555}}
 +
{{#set: left-end-position=35350}}
 +
{{#set: centisome-position=10.349027    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ17379

  • transcription-direction:
    • negative
  • right-end-position:
    • 67555
  • left-end-position:
    • 35350
  • centisome-position:
    • 10.349027

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway