Difference between revisions of "SJ12357"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17401 CPD-17401] == * common-name: ** 3-oxo-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13667 CPD-13667] == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13667 CPD-13667] == |
* common-name: | * common-name: | ||
− | ** | + | ** 11-oxo-β-amyrin |
* smiles: | * smiles: | ||
− | ** | + | ** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ukaiybgrlwqhdq-vcuiepqisa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 440.708 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13492]] |
+ | * [[RXN-13506]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=11-oxo-β-amyrin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ukaiybgrlwqhdq-vcuiepqisa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=440.708}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-13667
- common-name:
- 11-oxo-β-amyrin
- smiles:
- cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
- inchi-key:
- ukaiybgrlwqhdq-vcuiepqisa-n
- molecular-weight:
- 440.708