Difference between revisions of "SJ12357"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17401 CPD-17401] == * common-name: ** 3-oxo-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13667 CPD-13667] == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17401 CPD-17401] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13667 CPD-13667] ==
 
* common-name:
 
* common-name:
** 3-oxo-auricoloyl-coa
+
** 11-oxo-β-amyrin
 
* smiles:
 
* smiles:
** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
 
* inchi-key:
 
* inchi-key:
** fgcwebktqlbclr-jrszcninsa-j
+
** ukaiybgrlwqhdq-vcuiepqisa-n
 
* molecular-weight:
 
* molecular-weight:
** 1083.973
+
** 440.708
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16154]]
+
* [[RXN-13492]]
 +
* [[RXN-13506]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16153]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-auricoloyl-coa}}
+
{{#set: common-name=11-oxo-β-amyrin}}
{{#set: inchi-key=inchikey=fgcwebktqlbclr-jrszcninsa-j}}
+
{{#set: inchi-key=inchikey=ukaiybgrlwqhdq-vcuiepqisa-n}}
{{#set: molecular-weight=1083.973}}
+
{{#set: molecular-weight=440.708}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-13667

  • common-name:
    • 11-oxo-β-amyrin
  • smiles:
    • cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
  • inchi-key:
    • ukaiybgrlwqhdq-vcuiepqisa-n
  • molecular-weight:
    • 440.708

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality