Difference between revisions of "SJ12361"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * common-name: ** 4-methylumbelliferyl glucoside * smiles: ** cc3(c2(c=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquitin-activating-protein-E1-L-cys Ubiquitin-activating-protein-E1-L-cys] == * common-name:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquitin-activating-protein-E1-L-cys Ubiquitin-activating-protein-E1-L-cys] ==
 
* common-name:
 
* common-name:
** 4-methylumbelliferyl glucoside
+
** an [e1 ubiquitin-activating enzyme]-l-cysteine
* smiles:
 
** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3))
 
* inchi-key:
 
** yudptgpsbjvhcn-ymiltqatsa-n
 
* molecular-weight:
 
** 338.313
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10769]]
+
* [[RXN-15565]]
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15556]]
 +
* [[RXN-15563]]
 +
* [[RXN-15565]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-methylumbelliferyl glucoside}}
+
{{#set: common-name=an [e1 ubiquitin-activating enzyme]-l-cysteine}}
{{#set: inchi-key=inchikey=yudptgpsbjvhcn-ymiltqatsa-n}}
 
{{#set: molecular-weight=338.313}}
 

Revision as of 14:20, 26 August 2019

Metabolite Ubiquitin-activating-protein-E1-L-cys

  • common-name:
    • an [e1 ubiquitin-activating enzyme]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [e1 ubiquitin-activating enzyme]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.