Difference between revisions of "SJ12409"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == * common-name: ** (+)-7-epi-jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc([o-...")
(Created page with "Category:gene == Gene SJ12409 == * transcription-direction: ** positive * right-end-position: ** 270862 * left-end-position: ** 258302 * centisome-position: ** 72.107285...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] ==
+
== Gene SJ12409 ==
* common-name:
+
* transcription-direction:
** (+)-7-epi-jasmonate
+
** positive
* smiles:
+
* right-end-position:
** ccc=ccc1(c(=o)ccc1cc([o-])=o)
+
** 270862
* inchi-key:
+
* left-end-position:
** znjfbwydhiglcu-qkmqqoolsa-m
+
** 258302
* molecular-weight:
+
* centisome-position:
** 209.264
+
** 72.107285   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-10708]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[CHD-RXN]]
{{#set: common-name=(+)-7-epi-jasmonate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=znjfbwydhiglcu-qkmqqoolsa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=209.264}}
+
* [[RXN0-7230]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[BETSYN-PWY]]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
* [[CHOLINE-BETAINE-ANA-PWY]]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=270862}}
 +
{{#set: left-end-position=258302}}
 +
{{#set: centisome-position=72.107285    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ12409

  • transcription-direction:
    • positive
  • right-end-position:
    • 270862
  • left-end-position:
    • 258302
  • centisome-position:
    • 72.107285

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated