Difference between revisions of "SJ12409"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13852 CPD-13852] == * common-name: ** 2-hydroxy-damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6] == * common-name: ** (5s)-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (5s)-hpete |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jnuunuqhxiofda-jgklhwiesa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 335.462 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8647]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ARACHIDONATE-5-LIPOXYGENASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(5s)-hpete}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jnuunuqhxiofda-jgklhwiesa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=335.462}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6
- common-name:
- (5s)-hpete
- smiles:
- cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o
- inchi-key:
- jnuunuqhxiofda-jgklhwiesa-m
- molecular-weight:
- 335.462
