Difference between revisions of "SJ12486"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-SEROTONIN N-ACETYL-SEROTONIN] == * common-name: ** n-acetyl-serotonin * smiles: ** cc(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16475 CPD-16475] == * common-name: ** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1&...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16475 CPD-16475] == |
* common-name: | * common-name: | ||
| − | ** n-acetyl- | + | ** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc3(c(o)c(o)c(o)c(oc2(c(nc(c)=o)c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))2))o3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hbbozfuqjdyasd-qgtnpelvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 529.494 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15268]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15268]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=n-acetyl- | + | {{#set: common-name=β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hbbozfuqjdyasd-qgtnpelvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=529.494}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-16475
- common-name:
- β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine
- smiles:
- cc3(c(o)c(o)c(o)c(oc2(c(nc(c)=o)c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))2))o3)
- inchi-key:
- hbbozfuqjdyasd-qgtnpelvsa-n
- molecular-weight:
- 529.494
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
