Difference between revisions of "SJ12498"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9868 CPD-9868] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=His-tRNA-Adenosine4 His-tRNA-Adenosine4] ==
 * common-name:
-** 3-(all-trans-nonaprenyl)benzene-1,2-diol
+** an adenosine4 in trnahis
-* smiles:
-** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c
-* inchi-key:
-** pkyzmvivzpjxfm-xbvqzqhusa-n
-* molecular-weight:
-** 723.176
 == Reaction(s) known to consume the compound ==
-* [[RXN-9240]]
+* [[RXN-12479]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-(all-trans-nonaprenyl)benzene-1,2-diol}}
+{{#set: common-name=an adenosine4 in trnahis}}
-{{#set: inchi-key=inchikey=pkyzmvivzpjxfm-xbvqzqhusa-n}}
-{{#set: molecular-weight=723.176}}