Difference between revisions of "SJ12638"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14553 CPD-14553] == * common-name: ** udp-α-d-galactose * smiles: ** c(o)c1(c(o)c(o)c...")
(Created page with "Category:gene == Gene SJ12638 == * transcription-direction: ** positive * right-end-position: ** 298318 * left-end-position: ** 295426 * centisome-position: ** 82.83987...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14553 CPD-14553] ==
+
== Gene SJ12638 ==
* common-name:
+
* transcription-direction:
** udp-α-d-galactose
+
** positive
* smiles:
+
* right-end-position:
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
+
** 298318
* inchi-key:
+
* left-end-position:
** hscjrczfdfqwrp-abvwguqpsa-l
+
** 295426
* molecular-weight:
+
* centisome-position:
** 564.289
+
** 82.83987   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[S.japonica_carotenoid_curated]]
* [[2.4.1.122-RXN]]
+
== Reaction(s) associated ==
* [[2.4.1.123-RXN]]
+
* [[OXALATE-DECARBOXYLASE-RXN]]
* [[2.4.1.134-RXN]]
+
** Category: [[annotation]]
* [[2.4.1.151-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[2.4.1.38-RXN]]
+
== Pathway(s) associated ==
* [[2.4.1.46-RXN]]
+
* [[PWY-6698]]
* [[GALACTURIDYLYLTRANS-RXN]]
+
** '''1''' reactions found over '''1''' reactions in the full pathway
* [[LACTOSE-SYNTHASE-RXN]]
+
{{#set: transcription-direction=positive}}
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
+
{{#set: right-end-position=298318}}
* [[RXN-1225]]
+
{{#set: left-end-position=295426}}
* [[RXN-14561]]
+
{{#set: centisome-position=82.83987    }}
* [[RXN-15276]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[RXN-15277]]
+
{{#set: nb reaction associated=1}}
* [[RXN-15278]]
+
{{#set: nb pathway associated=1}}
* [[RXN-16027]]
 
* [[RXN-18266]]
 
* [[RXN-18302]]
 
* [[UDPGALtg]]
 
* [[UDPGALth]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UG4E]]
 
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
</div>
 
== Reaction(s) known to produce the compound ==
 
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[RXN-16027]]
 
* [[UDPGALtg]]
 
* [[UDPGALth]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UG4E]]
 
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=udp-&alpha;-d-galactose}}
 
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-abvwguqpsa-l}}
 
{{#set: molecular-weight=564.289}}
 

Latest revision as of 11:03, 18 March 2021

Gene SJ12638

  • transcription-direction:
    • positive
  • right-end-position:
    • 298318
  • left-end-position:
    • 295426
  • centisome-position:
    • 82.83987

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6698
    • 1 reactions found over 1 reactions in the full pathway