Difference between revisions of "SJ12675"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == * common-name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(...")
(Created page with "Category:gene == Gene SJ13891 == * transcription-direction: ** positive * right-end-position: ** 16515 * left-end-position: ** 11920 * centisome-position: ** 3.6172292...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] ==
+
== Gene SJ13891 ==
* common-name:
+
* transcription-direction:
** α-d-ribose 5-phosphate
+
** positive
* smiles:
+
* right-end-position:
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
+
** 16515
* inchi-key:
+
* left-end-position:
** ktvpxoyakdprhy-aihaylrmsa-l
+
** 11920
* molecular-weight:
+
* centisome-position:
** 228.095
+
** 3.6172292   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[R5PDP]]
+
* [[S.japonica_sterols_curated]]
* [[RPDPK]]
+
== Reaction(s) associated ==
* [[RXN-14456]]
+
* [[3.4.25.1-RXN]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[ARDP]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RIBOKIN-RXN]]
+
** Category: [[orthology]]
* [[RPDPK]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-14456]]
+
{{#set: transcription-direction=positive}}
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
+
{{#set: right-end-position=16515}}
== Reaction(s) of unknown directionality ==
+
{{#set: left-end-position=11920}}
{{#set: common-name=α-d-ribose 5-phosphate}}
+
{{#set: centisome-position=3.6172292    }}
{{#set: inchi-key=inchikey=ktvpxoyakdprhy-aihaylrmsa-l}}
+
{{#set: organism associated=S.japonica_sterols_curated}}
{{#set: molecular-weight=228.095}}
+
{{#set: nb reaction associated=1}}

Revision as of 20:19, 18 December 2020

Gene SJ13891

  • transcription-direction:
    • positive
  • right-end-position:
    • 16515
  • left-end-position:
    • 11920
  • centisome-position:
    • 3.6172292

Organism(s) associated with this gene

Reaction(s) associated