Difference between revisions of "SJ12900"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] == * common-name: ** gdp-α-d-glucose * smiles: ** c(o)c1(c(o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiocarboxylated-MPT-synthases Thiocarboxylated-MPT-synthases] == * common-name: ** a thiocarbo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiocarboxylated-MPT-synthases Thiocarboxylated-MPT-synthases] ==
 
* common-name:
 
* common-name:
** gdp-α-d-glucose
+
** a thiocarboxylated [small subunit of molybdopterin synthase]
* smiles:
 
** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
 
* inchi-key:
 
** mvmscbbuihutgj-lrjdveewsa-l
 
* molecular-weight:
 
** 603.329
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12486]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12486]]
+
* [[RXN-12473]]
* [[RXN4FS-13]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-α-d-glucose}}
+
{{#set: common-name=a thiocarboxylated [small subunit of molybdopterin synthase]}}
{{#set: inchi-key=inchikey=mvmscbbuihutgj-lrjdveewsa-l}}
 
{{#set: molecular-weight=603.329}}
 

Revision as of 14:20, 26 August 2019

Metabolite Thiocarboxylated-MPT-synthases

  • common-name:
    • a thiocarboxylated [small subunit of molybdopterin synthase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a thiocarboxylated [small subunit of molybdopterin synthase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.