Difference between revisions of "SJ12900"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7158 CPD-7158] == * common-name: ** 3-demethylubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c...")
(Created page with "Category:gene == Gene SJ21923 == * transcription-direction: ** negative * right-end-position: ** 84693 * left-end-position: ** 70061 * centisome-position: ** 38.183918...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7158 CPD-7158] ==
+
== Gene SJ21923 ==
* common-name:
+
* transcription-direction:
** 3-demethylubiquinol-9
+
** negative
* smiles:
+
* right-end-position:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(o)=c(o)c(oc)=c(o)1)
+
** 84693
* inchi-key:
+
* left-end-position:
** alajatogwwbpqt-nscwjznlsa-n
+
** 70061
* molecular-weight:
+
* centisome-position:
** 783.228
+
** 38.183918   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[2.1.1.64-RXN]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[PROTEIN-KINASE-RXN]]
{{#set: common-name=3-demethylubiquinol-9}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=alajatogwwbpqt-nscwjznlsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=783.228}}
+
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=84693}}
 +
{{#set: left-end-position=70061}}
 +
{{#set: centisome-position=38.183918    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:22, 18 December 2020

Gene SJ21923

  • transcription-direction:
    • negative
  • right-end-position:
    • 84693
  • left-end-position:
    • 70061
  • centisome-position:
    • 38.183918

Organism(s) associated with this gene

Reaction(s) associated