Difference between revisions of "SJ12953"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-dihydrosterculate Lipid-dihydrosterculate] == * common-name: ** a [glycerolipid]-dihydros...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1823 CPD-1823] == * common-name: ** nπ-methyl-l-histidine * smiles: ** cn1(c=nc=c1cc(c(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1823 CPD-1823] == |
* common-name: | * common-name: | ||
| − | ** | + | ** nπ-methyl-l-histidine |
| + | * smiles: | ||
| + | ** cn1(c=nc=c1cc(c(=o)[o-])[n+]) | ||
| + | * inchi-key: | ||
| + | ** jdhildinmrgule-lurjtmiesa-n | ||
| + | * molecular-weight: | ||
| + | ** 169.183 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[X-METHYL-HIS-DIPEPTIDASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=nπ-methyl-l-histidine}} |
| + | {{#set: inchi-key=inchikey=jdhildinmrgule-lurjtmiesa-n}} | ||
| + | {{#set: molecular-weight=169.183}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-1823
- common-name:
- nπ-methyl-l-histidine
- smiles:
- cn1(c=nc=c1cc(c(=o)[o-])[n+])
- inchi-key:
- jdhildinmrgule-lurjtmiesa-n
- molecular-weight:
- 169.183
