Difference between revisions of "SJ12977"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] == * common-name: ** 3-phospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(o)c(=o)[o...")
(Created page with "Category:gene == Gene SJ12977 == * transcription-direction: ** negative * right-end-position: ** 187513 * left-end-position: ** 137917 * centisome-position: ** 18.618336...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] ==
+
== Gene SJ12977 ==
* common-name:
+
* transcription-direction:
** 3-phospho-d-glycerate
+
** negative
* smiles:
+
* right-end-position:
** c(op(=o)([o-])[o-])c(o)c(=o)[o-]
+
** 187513
* inchi-key:
+
* left-end-position:
** osjppgntcrnqqc-uwtatzphsa-k
+
** 137917
* molecular-weight:
+
* centisome-position:
** 183.034
+
** 18.618336   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[3PGAREARR-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[PGLYCDEHYDROG-RXN]]
+
== Reaction(s) associated ==
* [[PHOSGLYPHOS-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-15511]]
+
** Category: [[annotation]]
* [[RXN-15513]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-17276]]
+
{{#set: transcription-direction=negative}}
== Reaction(s) known to produce the compound ==
+
{{#set: right-end-position=187513}}
* [[3PGAREARR-RXN]]
+
{{#set: left-end-position=137917}}
* [[GLY3KIN-RXN]]
+
{{#set: centisome-position=18.618336    }}
* [[PGLYCDEHYDROG-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[PHOSGLYPHOS-RXN]]
+
{{#set: nb reaction associated=1}}
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
 
* [[RXN-15511]]
 
* [[RXN-15513]]
 
* [[RXN-17274]]
 
* [[RXN-3443]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=3-phospho-d-glycerate}}
 
{{#set: inchi-key=inchikey=osjppgntcrnqqc-uwtatzphsa-k}}
 
{{#set: molecular-weight=183.034}}
 

Latest revision as of 11:03, 18 March 2021

Gene SJ12977

  • transcription-direction:
    • negative
  • right-end-position:
    • 187513
  • left-end-position:
    • 137917
  • centisome-position:
    • 18.618336

Organism(s) associated with this gene

Reaction(s) associated