Difference between revisions of "SJ12990"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] == * common-name: ** (2r)-homocitrate * smiles: ** c(c([o-])=o)cc(o)(c([o-])...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-fragment tRNA-fragment] == * common-name: ** a trna fragment == Reaction(s) known to consu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-fragment tRNA-fragment] ==
 
* common-name:
 
* common-name:
** (2r)-homocitrate
+
** a trna fragment
* smiles:
 
** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
 
* inchi-key:
 
** xkjvevrqmlksmo-ssdottswsa-k
 
* molecular-weight:
 
** 203.128
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13722]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13722]]
+
* [[3.1.26.5-RXN]]
 +
* [[RXN0-6480]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r)-homocitrate}}
+
{{#set: common-name=a trna fragment}}
{{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}}
 
{{#set: molecular-weight=203.128}}
 

Revision as of 14:19, 26 August 2019

Metabolite tRNA-fragment

  • common-name:
    • a trna fragment

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality