Difference between revisions of "SJ12990"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-fragment tRNA-fragment] == * common-name: ** a trna fragment == Reaction(s) known to consu...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE] == * common-name: ** (r)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-fragment tRNA-fragment] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE] ==
 
* common-name:
 
* common-name:
** a trna fragment
+
** (r)-4'-phosphopantothenoyl-l-cysteine
 +
* smiles:
 +
** cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-]
 +
* inchi-key:
 +
** xqyalqvlcnhcft-cbapkceasa-k
 +
* molecular-weight:
 +
** 399.332
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[P-PANTOCYSDECARB-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.26.5-RXN]]
+
* [[P-PANTOCYSLIG-RXN]]
* [[RXN0-6480]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trna fragment}}
+
{{#set: common-name=(r)-4'-phosphopantothenoyl-l-cysteine}}
 +
{{#set: inchi-key=inchikey=xqyalqvlcnhcft-cbapkceasa-k}}
 +
{{#set: molecular-weight=399.332}}

Revision as of 09:24, 27 August 2019

Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE

  • common-name:
    • (r)-4'-phosphopantothenoyl-l-cysteine
  • smiles:
    • cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-]
  • inchi-key:
    • xqyalqvlcnhcft-cbapkceasa-k
  • molecular-weight:
    • 399.332

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality