Difference between revisions of "SJ12990"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE] == * common-name: ** (r)...")
(Created page with "Category:gene == Gene SJ16170 == * transcription-direction: ** positive * right-end-position: ** 81495 * left-end-position: ** 78421 * centisome-position: ** 27.358994...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE] ==
+
== Gene SJ16170 ==
−
* common-name:
+
* transcription-direction:
−
** (r)-4'-phosphopantothenoyl-l-cysteine
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-]
+
** 81495
−
* inchi-key:
+
* left-end-position:
−
** xqyalqvlcnhcft-cbapkceasa-k
+
** 78421
−
* molecular-weight:
+
* centisome-position:
−
** 399.332
+
** 27.358994   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[P-PANTOCYSDECARB-RXN]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[P-PANTOCYSLIG-RXN]]
+
* [[RXN-16889]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=(r)-4'-phosphopantothenoyl-l-cysteine}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=xqyalqvlcnhcft-cbapkceasa-k}}
+
* [[RXN-16891]]
−
{{#set: molecular-weight=399.332}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-17121]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=81495}}
 +
{{#set: left-end-position=78421}}
 +
{{#set: centisome-position=27.358994    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}

Revision as of 20:20, 18 December 2020

Gene SJ16170

  • transcription-direction:
    • positive
  • right-end-position:
    • 81495
  • left-end-position:
    • 78421
  • centisome-position:
    • 27.358994

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ12990&oldid=41120"